CymitQuimica logo

CAS 898783-53-4

:

ethyl 3-[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate

Description:
Ethyl 3-[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate, identified by its CAS number 898783-53-4, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group and a piperazine moiety. This compound features a benzoate backbone, which contributes to its aromatic properties, and a piperazine ring that is known for its biological activity, often enhancing solubility and interaction with biological targets. The presence of the methyl group on the piperazine ring can influence its pharmacological properties, potentially affecting its binding affinity and selectivity. Ethyl 3-[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate may exhibit various chemical behaviors, including solubility in organic solvents and potential reactivity under specific conditions. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many compounds of this nature, understanding its characteristics requires further investigation into its physical properties, stability, and biological interactions.
Formula:C22H26N2O3
InChI:InChI=1/C22H26N2O3/c1-3-27-22(26)20-6-4-5-19(15-20)21(25)18-9-7-17(8-10-18)16-24-13-11-23(2)12-14-24/h4-10,15H,3,11-14,16H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.