CAS 898783-57-8

(3-Bromophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

Description:

(3-Bromophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone, with the CAS number 898783-57-8, is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties, while the piperazine ring is often associated with various therapeutic effects, including anxiolytic and antidepressant activities. The methanone functional group indicates that it is a ketone, which can participate in various chemical reactions, such as nucleophilic additions. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary depending on the specific substituents and overall molecular structure. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and drug development.

Formula: C₁₉H₂₁BrN₂O

InChI: InChI=1S/C19H21BrN2O/c1-21-9-11-22(12-10-21)14-15-5-7-16(8-6-15)19(23)17-3-2-4-18(20)13-17/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=ZZSBYVCBOSSDJV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCN(C)CC3)C=C2

Synonyms:

• Methanone, (3-bromophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (3-Bromophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone