CAS 898783-61-4

Methanone, (3-chlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-chlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and biological activity. Additionally, the compound features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, often associated with pharmacological properties. The methyl substitution on the piperazine enhances its lipophilicity, potentially affecting its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological pathways. Overall, the characteristics of this compound suggest it may have applications in drug design or as a research chemical, although specific biological activities would require further investigation.

Formula: C₁₉H₂₁ClN₂O

InChI: InChI=1/C19H21ClN2O/c1-21-9-11-22(12-10-21)14-15-5-7-16(8-6-15)19(23)17-3-2-4-18(20)13-17/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=QCSKJBREPSXYHS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCN(C)CC3)C=C2

Synonyms:

• (3-Chlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 3-Chloro-4′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-chlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

3-chloro-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-61-4

Formula: C₁₉H₂₁ClN₂O

Purity: 97.0%

Molecular weight: 328.84

Ref: 10-F204558