CAS 898783-63-6

(4-chlorophenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:

The chemical substance known as (4-chlorophenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-63-6, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a piperazine moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the piperazine ring, which is often found in pharmaceuticals. The chlorophenyl group may contribute to its lipophilicity, influencing its solubility and permeability in biological systems. The compound's molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis involves standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₉H₂₁ClN₂O

InChI: InChI=1/C19H21ClN2O/c1-21-10-12-22(13-11-21)14-15-2-4-16(5-3-15)19(23)17-6-8-18(20)9-7-17/h2-9H,10-14H2,1H3

SMILES: CN1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccc(cc1)Cl