CAS 898783-69-2

Methanone, (2,3-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,3-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,3-dimethylphenyl and 4-(4-methyl-1-piperazinyl)methylphenyl substituents contributes to its potential biological activity and lipophilicity. This compound is likely to exhibit moderate to high solubility in organic solvents due to its aromatic nature, while its piperazine moiety may enhance its interaction with biological targets, making it of interest in medicinal chemistry. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas. As with many organic compounds, the specific reactivity and stability can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1S/C21H26N2O/c1-16-5-4-6-20(17(16)2)21(24)19-9-7-18(8-10-19)15-23-13-11-22(3)12-14-23/h4-10H,11-15H2,1-3H3

InChI key: InChIKey=HICHZMKYLBHYOT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCN(C)CC2)C=C1)C3=C(C)C(C)=CC=C3

Synonyms:

• (2,3-Dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2,3-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

2,3-dimethyl-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-69-2

Formula: C₂₁H₂₆N₂O

Purity: 97.0%

Molecular weight: 322.452

Ref: 10-F204562