CAS 898783-73-8

(2,5-dimethylphenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:

The chemical substance known as (2,5-dimethylphenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-73-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, indicating potential biological activity, particularly in medicinal chemistry. The presence of the piperazine ring suggests that it may interact with various biological targets, making it of interest in drug development. Its molecular structure contributes to its solubility and reactivity, which can influence its pharmacokinetic properties. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility in various solvents, which are essential for its application in research and industry. Overall, this compound's unique characteristics make it a subject of interest in the fields of organic synthesis and pharmaceutical research.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1/C21H26N2O/c1-16-4-5-17(2)20(14-16)21(24)19-8-6-18(7-9-19)15-23-12-10-22(3)11-13-23/h4-9,14H,10-13,15H2,1-3H3

SMILES: Cc1ccc(C)c(c1)C(=O)c1ccc(cc1)CN1CCN(C)CC1

2,5-dimethyl-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-73-8

Formula: C₂₁H₂₆N₂O

Purity: 97.0%

Molecular weight: 322.452

Ref: 10-F204564