CymitQuimica logo

CAS 898783-75-0

:

(2,6-dimethylphenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
The chemical substance known as (2,6-dimethylphenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-75-0, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, which is known for its biological activity and potential pharmacological applications. The presence of the piperazine ring suggests that this compound may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand for various biological targets. Its molecular structure indicates potential lipophilicity, which could influence its solubility and permeability in biological systems. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound may be of interest in research related to drug development and the study of its biological effects.
Formula:C21H26N2O
InChI:InChI=1/C21H26N2O/c1-16-5-4-6-17(2)20(16)21(24)19-9-7-18(8-10-19)15-23-13-11-22(3)12-14-23/h4-10H,11-15H2,1-3H3
SMILES:Cc1cccc(C)c1C(=O)c1ccc(cc1)CN1CCN(C)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.