CAS 898783-76-1
:8-(4-chlorophenyl)-8-oxo-octanenitrile
Description:
8-(4-chlorophenyl)-8-oxo-octanenitrile, identified by its CAS number 898783-76-1, is a chemical compound characterized by its unique structure, which includes an octane backbone with a nitrile functional group and a ketone group adjacent to a para-substituted chlorophenyl moiety. This compound typically exhibits properties associated with both organic nitriles and ketones, such as moderate polarity and potential reactivity in nucleophilic addition reactions. The presence of the chlorophenyl group may impart specific electronic effects, influencing the compound's reactivity and solubility in various solvents. Additionally, the nitrile group contributes to the compound's potential applications in organic synthesis and medicinal chemistry, where it may serve as an intermediate or a building block for more complex molecules. Overall, the characteristics of this compound make it of interest in various fields, including pharmaceuticals and agrochemicals, where its unique functional groups can be exploited for specific chemical transformations.
Formula:C14H16ClNO
InChI:InChI=1/C14H16ClNO/c15-13-9-7-12(8-10-13)14(17)6-4-2-1-3-5-11-16/h7-10H,1-6H2
SMILES:C(CCCC(=O)c1ccc(cc1)Cl)CCC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.