CAS 898783-77-2

Methanone, (3,4-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dimethylphenyl and 4-(4-methyl-1-piperazinyl)methylphenyl substituents indicates that this compound has significant steric and electronic properties, potentially influencing its reactivity and interactions. The piperazine moiety suggests that the compound may exhibit biological activity, as piperazine derivatives are often found in pharmaceuticals. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. Its molecular weight and specific functional groups may contribute to its stability and potential applications in medicinal chemistry or as a research chemical. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with complex structures that may pose unknown risks.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1S/C21H26N2O/c1-16-4-7-20(14-17(16)2)21(24)19-8-5-18(6-9-19)15-23-12-10-22(3)11-13-23/h4-9,14H,10-13,15H2,1-3H3

InChI key: InChIKey=PPKQEZQWHWVVEL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=C(C)C=C1)C2=CC=C(CN3CCN(C)CC3)C=C2

Synonyms:

• (3,4-Dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (3,4-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-