CAS 898783-79-4

Methanone, (3,5-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3,5-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, enhancing its hydrophobic properties. Additionally, the compound features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity and solubility characteristics. This compound may exhibit various pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the piperazine group, which can participate in hydrogen bonding and other interactions with biological targets. Overall, Methanone, (3,5-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- represents a class of compounds that may have applications in drug development or as research tools in biochemistry.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1/C21H26N2O/c1-16-12-17(2)14-20(13-16)21(24)19-6-4-18(5-7-19)15-23-10-8-22(3)9-11-23/h4-7,12-14H,8-11,15H2,1-3H3

InChI key: InChIKey=VQKLFIBPCAPXHF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=CC(C)=C1)C2=CC=C(CN3CCN(C)CC3)C=C2

Synonyms:

• (3,5-Dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (3,5-dimethylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

3,5-dimethyl-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-79-4

Formula: C₂₁H₂₆N₂O

Purity: 97.0%

Molecular weight: 322.452

Ref: 10-F204567