CAS 898783-85-2

Methanone, (3-chloro-4-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacological applications, particularly in the development of psychoactive drugs. Its molecular structure suggests that it may exhibit properties such as lipophilicity, which can influence its solubility and permeability in biological systems. The specific arrangement of substituents can affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 898783-85-2, allows for easy identification and retrieval of information related to its synthesis, properties, and potential applications in research and industry. Overall, this compound exemplifies the intricate relationship between molecular structure and function in chemical substances.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-8-10-23(11-9-22)13-14-2-4-15(5-3-14)19(24)16-6-7-18(21)17(20)12-16/h2-7,12H,8-11,13H2,1H3

InChI key: InChIKey=KLJXYUBNZXVVDZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(F)C=C1)C2=CC=C(CN3CCN(C)CC3)C=C2

Synonyms:

• (3-Chloro-4-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

3-chloro-4-fluoro-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-85-2

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F204570