CAS 898783-86-3
:Ethanone, 2-(2-bromophenyl)-1-(4-iodophenyl)-
Description:
Ethanone, 2-(2-bromophenyl)-1-(4-iodophenyl)-, also known by its CAS number 898783-86-3, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic substituents. The structure features a central ethanone moiety, with a bromophenyl group at one position and an iodophenyl group at another, contributing to its unique chemical properties. This compound is likely to exhibit significant lipophilicity due to the presence of the aromatic rings, which can influence its solubility and reactivity. The halogen substituents (bromine and iodine) can also impart specific electronic effects, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of these halogens may affect the compound's stability and interaction with biological systems, making it of interest in medicinal chemistry and material science. Overall, the compound's unique structure suggests potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C14H10BrIO
InChI:InChI=1S/C14H10BrIO/c15-13-4-2-1-3-11(13)9-14(17)10-5-7-12(16)8-6-10/h1-8H,9H2
InChI key:InChIKey=SDOXYLXFOUGVMT-UHFFFAOYSA-N
SMILES:C(CC1=C(Br)C=CC=C1)(=O)C2=CC=C(I)C=C2
Synonyms:- Ethanone, 2-(2-bromophenyl)-1-(4-iodophenyl)-
- 2-(2-Bromophenyl)-1-(4-iodophenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.