CAS 898783-87-4

(2-chlorophenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:

The chemical substance known as (2-chlorophenyl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-87-4, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The chlorophenyl substituent may influence its electronic properties and reactivity, while the methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug discovery and development contexts.

Formula: C₁₉H₂₁ClN₂O

InChI: InChI=1/C19H21ClN2O/c1-21-10-12-22(13-11-21)14-15-6-8-16(9-7-15)19(23)17-4-2-3-5-18(17)20/h2-9H,10-14H2,1H3

SMILES: CN1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccccc1Cl