CAS 898783-89-6

Methanone, (2-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a fluorine atom on the phenyl ring suggests potential for increased reactivity and altered electronic properties compared to non-fluorinated analogs. The compound also features a piperazine moiety, which is known for its role in enhancing solubility and biological activity, making it of interest in pharmaceutical applications. The methyl group on the piperazine can influence the steric and electronic characteristics of the molecule, potentially affecting its interaction with biological targets. Overall, this compound exhibits properties typical of organic molecules with both aromatic and heterocyclic components, which may contribute to its utility in medicinal chemistry and drug design. Its specific applications would depend on further studies regarding its biological activity and pharmacokinetics.

Formula: C₁₉H₂₁FN₂O

InChI: InChI=1S/C19H21FN2O/c1-21-10-12-22(13-11-21)14-15-6-8-16(9-7-15)19(23)17-4-2-3-5-18(17)20/h2-9H,10-14H2,1H3

InChI key: InChIKey=RBZLYAXXZSSPEJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCN(C)CC2)C=C1)C3=C(F)C=CC=C3

Synonyms:

• (2-Fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2-fluorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

2-fluoro-4′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-89-6

Formula: C₁₉H₂₁FN₂O

Purity: 97.0%

Molecular weight: 312.388

Ref: 10-F204572