CAS 898783-94-3

2-(4-bromophenyl)-1-(2-iodophenyl)ethanone

Description:

2-(4-bromophenyl)-1-(2-iodophenyl)ethanone, with the CAS number 898783-94-3, is an organic compound characterized by its ketone functional group and the presence of bromine and iodine substituents on its aromatic rings. This compound features a central ethanone structure, where the carbonyl group (C=O) is flanked by two phenyl groups, one of which has a bromine atom at the para position and the other an iodine atom at the ortho position. The presence of these halogens can significantly influence the compound's reactivity, stability, and solubility. Typically, such compounds may exhibit interesting electronic properties due to the electron-withdrawing nature of the halogens, which can affect their behavior in chemical reactions, including electrophilic substitutions or nucleophilic attacks. Additionally, the compound may have applications in organic synthesis, medicinal chemistry, or materials science, depending on its specific properties and reactivity patterns. Safety and handling precautions should be observed due to the potential hazards associated with halogenated compounds.

Formula: C₁₄H₁₀BrIO

InChI: InChI=1/C14H10BrIO/c15-11-7-5-10(6-8-11)9-14(17)12-3-1-2-4-13(12)16/h1-8H,9H2