CAS 898783-96-5
:Ethanone, 2-(4-bromophenyl)-1-(3-iodophenyl)-
Description:
Ethanone, 2-(4-bromophenyl)-1-(3-iodophenyl)-, also known by its CAS number 898783-96-5, is an organic compound characterized by its ketone functional group and the presence of two aromatic substituents. The structure features a central ethanone moiety, with a bromophenyl group at the 2-position and an iodophenyl group at the 1-position. This compound exhibits properties typical of aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents. The presence of bromine and iodine atoms can influence the compound's physical properties, such as solubility and boiling point, as well as its reactivity and stability. Additionally, the halogen atoms may impart unique characteristics, such as increased lipophilicity or altered electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Overall, this compound's unique structure and substituents suggest potential applications in synthetic organic chemistry and drug development.
Formula:C14H10BrIO
InChI:InChI=1/C14H10BrIO/c15-12-6-4-10(5-7-12)8-14(17)11-2-1-3-13(16)9-11/h1-7,9H,8H2
InChI key:InChIKey=NWCNVZVJEFHPOU-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Br)C=C1)(=O)C2=CC(I)=CC=C2
Synonyms:- Ethanone, 2-(4-bromophenyl)-1-(3-iodophenyl)-
- 2-(4-Bromophenyl)-1-(3-iodophenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.