CAS 898783-98-7

Ethanone, 2-(4-bromophenyl)-1-(4-iodophenyl)-

Description:

Ethanone, 2-(4-bromophenyl)-1-(4-iodophenyl)-, also known by its CAS number 898783-98-7, is an organic compound characterized by its ketone functional group and the presence of two aromatic substituents. The compound features a central ethanone structure, where one carbonyl group is flanked by a 4-bromophenyl group and a 4-iodophenyl group. This substitution pattern contributes to its unique chemical properties, including potential reactivity in electrophilic aromatic substitution reactions due to the electron-withdrawing effects of the halogen atoms. The presence of bromine and iodine atoms also suggests that the compound may exhibit interesting physical properties, such as altered solubility and melting points compared to similar compounds without halogen substituents. Additionally, the compound may have applications in organic synthesis, medicinal chemistry, or materials science, depending on its reactivity and stability. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₁₄H₁₀BrIO

InChI: InChI=1S/C14H10BrIO/c15-12-5-1-10(2-6-12)9-14(17)11-3-7-13(16)8-4-11/h1-8H,9H2

InChI key: InChIKey=OWSJPTUQAWCYRC-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(Br)C=C1)(=O)C2=CC=C(I)C=C2

Synonyms:

• Ethanone, 2-(4-bromophenyl)-1-(4-iodophenyl)-
• 2-(4-Bromophenyl)-1-(4-iodophenyl)ethan-1-one