CAS 898784-04-8

Ethanone, 2-(3-chlorophenyl)-1-(3-iodophenyl)-

Description:

Ethanone, 2-(3-chlorophenyl)-1-(3-iodophenyl)-, also known by its CAS number 898784-04-8, is an organic compound characterized by its ketone functional group and substituted aromatic rings. This compound features a central ethanone structure, where the carbonyl group (C=O) is flanked by two phenyl groups, one of which is substituted with a chlorine atom and the other with an iodine atom. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry and material science. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, due to the unique properties imparted by the halogen atoms. Additionally, the compound's stability, solubility, and interaction with other substances would depend on the specific conditions under which it is used, such as solvent type and temperature.

Formula: C₁₄H₁₀ClIO

InChI: InChI=1S/C14H10ClIO/c15-12-5-1-3-10(7-12)8-14(17)11-4-2-6-13(16)9-11/h1-7,9H,8H2

InChI key: InChIKey=FNIMAVCINKXQPT-UHFFFAOYSA-N

SMILES: C(C(=O)C1=CC(I)=CC=C1)C2=CC(Cl)=CC=C2

Synonyms:

• Ethanone, 2-(3-chlorophenyl)-1-(3-iodophenyl)-
• 2-(3-Chlorophenyl)-1-(3-iodophenyl)ethan-1-one