CAS 898784-07-1
:Ethanone, 2-(4-chlorophenyl)-1-(3-iodophenyl)-
Description:
Ethanone, 2-(4-chlorophenyl)-1-(3-iodophenyl)-, also known by its CAS number 898784-07-1, is an organic compound characterized by its ketone functional group and the presence of two aromatic substituents. The structure features a central ethanone moiety, with a 4-chlorophenyl group and a 3-iodophenyl group attached to the carbon atoms adjacent to the carbonyl group. This compound is likely to exhibit properties typical of aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents. The presence of chlorine and iodine can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical reactivity. Additionally, the compound may have applications in organic synthesis or medicinal chemistry, given the significance of halogenated aromatic compounds in drug development. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C14H10ClIO
InChI:InChI=1S/C14H10ClIO/c15-12-6-4-10(5-7-12)8-14(17)11-2-1-3-13(16)9-11/h1-7,9H,8H2
InChI key:InChIKey=XIJHKSNJRIIOBD-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Cl)C=C1)(=O)C2=CC(I)=CC=C2
Synonyms:- 2-(4-Chlorophenyl)-1-(3-iodophenyl)ethan-1-one
- Ethanone, 2-(4-chlorophenyl)-1-(3-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.