CAS 898784-13-9
:4-[2-(3-bromophenyl)acetyl]benzonitrile
Description:
4-[2-(3-Bromophenyl)acetyl]benzonitrile, with the CAS number 898784-13-9, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a bromophenyl acetyl group. This compound typically exhibits a solid state at room temperature and is likely to be sparingly soluble in water due to its hydrophobic aromatic components. It may show moderate to high stability under standard conditions, but like many organic compounds, it could be sensitive to light and heat. The presence of the bromine atom introduces unique reactivity and may influence its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its synthesis and handling would require standard laboratory safety protocols due to the presence of bromine and the potential toxicity of nitriles. Overall, 4-[2-(3-bromophenyl)acetyl]benzonitrile is a compound of interest in organic chemistry and medicinal chemistry.
Formula:C15H10BrNO
InChI:InChI=1/C15H10BrNO/c16-14-3-1-2-12(8-14)9-15(18)13-6-4-11(10-17)5-7-13/h1-8H,9H2
SMILES:c1cc(cc(c1)Br)CC(=O)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.