CAS 898784-16-2
:2-(2-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]ethanone
Description:
2-(2-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]ethanone, with the CAS number 898784-16-2, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound contains a bromophenyl group and a trifluoromethylphenyl group, which contribute to its unique chemical properties. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and polarity. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. Typically, such compounds exhibit interesting interactions in various chemical environments, including potential applications in pharmaceuticals or agrochemicals. The molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the trifluoromethyl group and the bromine substituent. Overall, this compound's characteristics make it a subject of interest for further research in synthetic organic chemistry and its potential applications in various fields.
Formula:C15H10BrF3O
InChI:InChI=1S/C15H10BrF3O/c16-13-8-4-1-5-10(13)9-14(20)11-6-2-3-7-12(11)15(17,18)19/h1-8H,9H2
InChI key:InChIKey=MCPUKYDFNVDYOT-UHFFFAOYSA-N
SMILES:C(CC1=C(Br)C=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- 2-(2-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]ethanone
- Ethanone, 2-(2-bromophenyl)-1-[2-(trifluoromethyl)phenyl]-
- 2-(2-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.