CAS 898784-18-4
:2-(2-bromophenyl)-1-[4-(trifluoromethyl)phenyl]ethanone
Description:
2-(2-bromophenyl)-1-[4-(trifluoromethyl)phenyl]ethanone, with the CAS number 898784-18-4, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a trifluoromethylphenyl group attached to an ethanone moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions due to the presence of electron-withdrawing groups like the trifluoromethyl group. The bromine atom can also influence the compound's reactivity and solubility in various solvents. Its molecular structure suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active molecules. Additionally, the presence of halogens and functional groups may impart unique physical properties, such as altered melting and boiling points compared to similar compounds. Overall, this compound's characteristics make it of interest in both synthetic chemistry and materials science.
Formula:C15H10BrF3O
InChI:InChI=1/C15H10BrF3O/c16-13-4-2-1-3-11(13)9-14(20)10-5-7-12(8-6-10)15(17,18)19/h1-8H,9H2
SMILES:c1ccc(c(c1)CC(=O)c1ccc(cc1)C(F)(F)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.