CAS 898784-20-8
:Ethanone, 2-(3-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-
Description:
Ethanone, 2-(3-bromophenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of a bromine atom and a trifluoromethyl group contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in electrophilic substitution reactions. This compound is likely to exhibit significant biological activity due to the presence of halogen substituents, which can influence its interaction with biological targets. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. Additionally, the compound's stability and solubility characteristics would be influenced by the aromatic systems and the electron-withdrawing nature of the trifluoromethyl group. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with halogenated substituents, which are of interest in various fields of chemical research and application.
Formula:C15H10BrF3O
InChI:InChI=1S/C15H10BrF3O/c16-13-6-1-3-10(7-13)8-14(20)11-4-2-5-12(9-11)15(17,18)19/h1-7,9H,8H2
InChI key:InChIKey=SKZSRQFBEZDCFQ-UHFFFAOYSA-N
SMILES:C(CC1=CC(Br)=CC=C1)(=O)C2=CC(C(F)(F)F)=CC=C2
Synonyms:- 2-(3-Bromophenyl)-1-[3-(trifluoromethyl)phenyl]ethan-1-one
- Ethanone, 2-(3-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.