CAS 898784-21-9
:2-(3-bromophenyl)-1-[4-(trifluoromethyl)phenyl]ethanone
Description:
2-(3-bromophenyl)-1-[4-(trifluoromethyl)phenyl]ethanone, with the CAS number 898784-21-9, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of a bromine atom and a trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in electrophilic substitution reactions. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and material science, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Its molecular structure suggests that it may exhibit interesting electronic properties, influenced by the electron-withdrawing trifluoromethyl group and the electron-donating bromophenyl moiety. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and conditions used, making it important to consider these factors in practical applications.
Formula:C15H10BrF3O
InChI:InChI=1/C15H10BrF3O/c16-13-3-1-2-10(8-13)9-14(20)11-4-6-12(7-5-11)15(17,18)19/h1-8H,9H2
SMILES:c1cc(cc(c1)Br)CC(=O)c1ccc(cc1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.