CAS 898784-22-0
:(2,5-dichlorophenyl)-oxazol-2-yl-methanone
Description:
(2,5-Dichlorophenyl)-oxazol-2-yl-methanone, with the CAS number 898784-22-0, is a chemical compound characterized by its unique structure, which includes a dichlorophenyl group and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the oxazole moiety. The dichlorophenyl group may impart specific electronic and steric effects, influencing the compound's reactivity and interactions with biological systems. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic characteristics. The presence of the oxazole ring suggests potential applications in pharmaceuticals or agrochemicals, as oxazole derivatives are often explored for their biological activities. Additionally, the compound may exhibit fluorescence or other optical properties, making it of interest in materials science. As with any chemical, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C10H5Cl2NO2
InChI:InChI=1/C10H5Cl2NO2/c11-6-1-2-8(12)7(5-6)9(14)10-13-3-4-15-10/h1-5H
SMILES:c1cc(c(cc1Cl)C(=O)c1ncco1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.