CAS 898784-23-1

Ethanone, 2-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

Ethanone, 2-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of a bromine atom and a trifluoromethyl group contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in electrophilic substitution reactions. This compound is likely to exhibit significant biological activity due to the presence of halogen substituents, which can influence its interaction with biological targets. It may also demonstrate stability under standard conditions, but its reactivity can vary based on the surrounding environment and the presence of other reagents. As a synthetic intermediate, it may be utilized in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the context of functionalized aromatic compounds.

Formula: C₁₅H₁₀BrF₃O

InChI: InChI=1S/C15H10BrF3O/c16-11-7-5-10(6-8-11)9-14(20)12-3-1-2-4-13(12)15(17,18)19/h1-8H,9H2

InChI key: InChIKey=UWWVOIIZMVHEMS-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(Br)C=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• Ethanone, 2-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]-
• 2-(4-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]ethan-1-one