CAS 898784-24-2
:(2,6-Dichlorophenyl)-2-oxazolylmethanone
Description:
(2,6-Dichlorophenyl)-2-oxazolylmethanone, identified by its CAS number 898784-24-2, is a chemical compound characterized by its unique structure that includes a dichlorophenyl group and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and stability. The presence of chlorine atoms on the phenyl ring can enhance its electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the oxazole moiety contributes to the compound's potential biological activity, as many oxazole derivatives are known for their pharmacological properties. The compound may be soluble in organic solvents, and its melting point and boiling point would depend on the specific conditions and purity. Overall, (2,6-Dichlorophenyl)-2-oxazolylmethanone is of interest in fields such as medicinal chemistry and materials science, where its unique structural features can be leveraged for the development of new compounds or materials.
Formula:C10H5Cl2NO2
InChI:InChI=1S/C10H5Cl2NO2/c11-6-2-1-3-7(12)8(6)9(14)10-13-4-5-15-10/h1-5H
InChI key:InChIKey=PVRUTDDVYBDAMB-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=CC=C1Cl)C2=NC=CO2
Synonyms:- (2,6-Dichlorophenyl)-2-oxazolylmethanone
- Methanone, (2,6-dichlorophenyl)-2-oxazolyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.