CAS 898784-25-3

2-(4-Bromophenyl)-1-[3-(trifluoromethyl)phenyl]ethanone

Description:

2-(4-Bromophenyl)-1-[3-(trifluoromethyl)phenyl]ethanone, with the CAS number 898784-25-3, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a central ethanone moiety substituted with a 4-bromophenyl group and a 3-(trifluoromethyl)phenyl group. The presence of the bromine atom and the trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The trifluoromethyl group is known for enhancing the metabolic stability of compounds, while the bromine atom can influence the compound's reactivity and interaction with biological targets. This substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, its molecular structure suggests potential applications in materials science and organic synthesis, particularly in the development of novel compounds with specific electronic or optical properties. As with many halogenated compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₁₅H₁₀BrF₃O

InChI: InChI=1/C15H10BrF3O/c16-13-6-4-10(5-7-13)8-14(20)11-2-1-3-12(9-11)15(17,18)19/h1-7,9H,8H2

InChI key: InChIKey=PWNWUZHCJWRAIH-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(Br)C=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 2-(4-Bromophenyl)-1-[3-(trifluoromethyl)phenyl]ethanone
• 2-(4-Bromophenyl)-1-[3-(trifluoromethyl)phenyl]ethan-1-one
• Ethanone, 2-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-
• 2-(4-Bromophenyl)-3′-trifluoromethylacetophenone