CAS 898784-27-5

Ethanone, 2-(4-bromophenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

Ethanone, 2-(4-bromophenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, specifically an ethanone structure with two distinct aromatic substituents. The presence of a bromine atom on one phenyl ring and a trifluoromethyl group on the other contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in electrophilic aromatic substitution reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group and the electron-donating characteristics of the bromophenyl moiety. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substituents can enhance biological activity or selectivity. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the presence of halogen atoms, which typically affect intermolecular interactions. Safety and handling considerations should be taken into account due to the presence of bromine and fluorine, which can pose environmental and health risks.

Formula: C₁₅H₁₀BrF₃O

InChI: InChI=1S/C15H10BrF3O/c16-13-7-1-10(2-8-13)9-14(20)11-3-5-12(6-4-11)15(17,18)19/h1-8H,9H2

InChI key: InChIKey=FSVDTRQXNCWVRI-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(Br)C=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 2-(4-Bromophenyl)-1-[4-(trifluoromethyl)phenyl]ethan-1-one
• Ethanone, 2-(4-bromophenyl)-1-[4-(trifluoromethyl)phenyl]-

2-(4-bromophenyl)-4′-trifluoromethylacetophenone

CAS: 898784-27-5

Formula: C₁₅H₁₀BrF₃O

Purity: 97.0%

Molecular weight: 343.143

Ref: 10-F203797