CymitQuimica logo

CAS 898784-29-7

:

2-[2-(2-Iodophenyl)-2-oxoethyl]benzonitrile

Description:
2-[2-(2-Iodophenyl)-2-oxoethyl]benzonitrile, with the CAS number 898784-29-7, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and an iodo-substituted phenyl group. This compound features a carbonyl group (ketone) adjacent to the iodo-phenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit properties such as polarity and the ability to participate in nucleophilic reactions. Additionally, the iodine atom can enhance the compound's reactivity due to its electronegative nature, making it a potential candidate for further chemical transformations. The compound's unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, 2-[2-(2-Iodophenyl)-2-oxoethyl]benzonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C15H10INO
InChI:InChI=1S/C15H10INO/c16-14-8-4-3-7-13(14)15(18)9-11-5-1-2-6-12(11)10-17/h1-8H,9H2
InChI key:InChIKey=LXHQVUGBMHXYSH-UHFFFAOYSA-N
SMILES:C(CC1=C(C#N)C=CC=C1)(=O)C2=C(I)C=CC=C2
Synonyms:
  • Benzonitrile, 2-[2-(2-iodophenyl)-2-oxoethyl]-
  • 2-[2-(2-Iodophenyl)-2-oxoethyl]benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.