CAS 898784-31-1

2-[2-(3-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:

2-[2-(3-Iodophenyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898784-31-1, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and a 3-iodophenyl group. This compound features a carbonyl group (ketone) adjacent to an ethyl chain, which is further substituted by a benzonitrile group. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may affect its solubility in organic solvents. Additionally, the nitrile functional group contributes to its polar character, potentially impacting its interactions in biological systems. As with many organic compounds, it may undergo various chemical reactions, including nucleophilic substitutions and reductions, depending on the conditions. Safety and handling precautions should be observed due to the presence of iodine, which can be hazardous.

Formula: C₁₅H₁₀INO

InChI: InChI=1/C15H10INO/c16-14-7-3-6-12(8-14)15(18)9-11-4-1-2-5-13(11)10-17/h1-8H,9H2

SMILES: c1ccc(C#N)c(c1)CC(=O)c1cccc(c1)I

2-(2-cyanophenyl)-3′-iodoacetophenone

CAS: 898784-31-1

Formula: C₁₅H₁₀INO

Purity: 97.0%

Molecular weight: 347.155

Ref: 10-F203799