CAS 898784-32-2
:(2,4-dimethoxyphenyl)-oxazol-2-yl-methanone
Description:
(2,4-Dimethoxyphenyl)-oxazol-2-yl-methanone, identified by its CAS number 898784-32-2, is a chemical compound characterized by its unique structural features. It contains an oxazole ring, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms, contributing to its potential biological activity. The presence of the dimethoxyphenyl group indicates that the compound has two methoxy (-OCH3) substituents on a phenyl ring, which can influence its solubility and reactivity. This compound may exhibit various properties such as fluorescence or photostability, depending on its molecular structure and substituents. Additionally, the methanone functional group suggests that it may participate in reactions typical of carbonyl compounds, such as nucleophilic addition. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and chemical reactivity. However, specific data on its toxicity, stability, and reactivity would require further investigation through experimental studies.
Formula:C12H11NO4
InChI:InChI=1/C12H11NO4/c1-15-8-3-4-9(10(7-8)16-2)11(14)12-13-5-6-17-12/h3-7H,1-2H3
SMILES:COc1ccc(c(c1)OC)C(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.