CAS 898784-33-3

2-[2-(4-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:

2-[2-(4-Iodophenyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898784-33-3, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and an iodo-substituted phenyl group. This compound features a carbonyl group (ketone) adjacent to the iodo-phenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the iodine atom can enhance the compound's electrophilic properties, making it useful in nucleophilic substitution reactions. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and functional groups that can interact with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the iodine substituent may pose specific hazards.

Formula: C₁₅H₁₀INO

InChI: InChI=1/C15H10INO/c16-14-7-5-11(6-8-14)15(18)9-12-3-1-2-4-13(12)10-17/h1-8H,9H2

SMILES: c1ccc(C#N)c(c1)CC(=O)c1ccc(cc1)I