CAS 898784-35-5

3-[2-(2-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:

3-[2-(2-Iodophenyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898784-35-5, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and an iodophenyl group. This compound features a nitrile functional group (-C≡N) attached to a benzene ring, which contributes to its aromatic properties and potential reactivity. The presence of the 2-iodophenyl group introduces halogen functionality, which can influence the compound's chemical behavior, including its reactivity and potential for substitution reactions. The ketone-like structure (2-oxo-ethyl) suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Additionally, the compound's molecular structure may impart specific physical properties, such as solubility in organic solvents and potential biological activity. Overall, this compound's unique combination of functional groups makes it of interest in synthetic organic chemistry and potentially in medicinal chemistry, where halogenated compounds often exhibit enhanced biological properties.

Formula: C₁₅H₁₀INO

InChI: InChI=1/C15H10INO/c16-14-7-2-1-6-13(14)15(18)9-11-4-3-5-12(8-11)10-17/h1-8H,9H2

SMILES: c1ccc(c(c1)C(=O)Cc1cccc(c1)C#N)I

Synonyms:

• 3-[2-(2-iodophenyl)-2-oxoethyl]benzonitrile
• Benzonitrile, 3-[2-(2-iodophenyl)-2-oxoethyl]-
• 2-(3-CYANOPHENYL)-2'-IODOACETOPHENONE