CAS 898784-37-7

3-[2-(3-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:

3-[2-(3-Iodophenyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898784-37-7, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and an iodophenyl group. This compound features a carbonyl group (ketone) adjacent to the iodophenyl ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility and interaction with other chemical species. Additionally, the iodine atom in the structure can enhance the compound's electrophilicity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound's unique structural features may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, 3-[2-(3-iodophenyl)-2-oxo-ethyl]benzonitrile is a versatile compound with potential applications in pharmaceuticals and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₅H₁₀INO

InChI: InChI=1/C15H10INO/c16-14-6-2-5-13(9-14)15(18)8-11-3-1-4-12(7-11)10-17/h1-7,9H,8H2

SMILES: c1cc(cc(c1)C#N)CC(=O)c1cccc(c1)I