CAS 898784-41-3

4-[2-(2-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:

4-[2-(2-Iodophenyl)-2-oxo-ethyl]benzonitrile, identified by its CAS number 898784-41-3, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and an iodophenyl group. This compound features a carbonyl group (ketone) adjacent to the iodophenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit notable electronic properties, making it useful in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the iodine atom can enhance the compound's reactivity due to its ability to participate in halogenation reactions or serve as a leaving group in substitution reactions. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may exhibit biological activity. Its solubility and stability in different solvents can vary, influencing its practical applications in laboratory and industrial settings.

Formula: C₁₅H₁₀INO

InChI: InChI=1/C15H10INO/c16-14-4-2-1-3-13(14)15(18)9-11-5-7-12(10-17)8-6-11/h1-8H,9H2

SMILES: c1ccc(c(c1)C(=O)Cc1ccc(cc1)C#N)I

2-(4-cyanophenyl)-2′-iodoacetophenone

CAS: 898784-41-3

Formula: C₁₅H₁₀INO

Purity: 97.0%

Molecular weight: 347.155

Ref: 10-F203804