CymitQuimica logo

CAS 898784-43-5

:

4-[2-(4-iodophenyl)-2-oxo-ethyl]benzonitrile

Description:
4-[2-(4-Iodophenyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898784-43-5, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and an iodo-substituted phenyl group. This compound features a carbonyl group (ketone) adjacent to the iodo-substituted phenyl, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the iodine atom can enhance the compound's electrophilicity, making it a potential candidate for further chemical transformations. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and functional groups that can interact with biological targets. Its stability and reactivity will depend on the specific conditions under which it is handled, including temperature, solvent choice, and the presence of other reactive species.
Formula:C15H10INO
InChI:InChI=1S/C15H10INO/c16-14-7-5-13(6-8-14)15(18)9-11-1-3-12(10-17)4-2-11/h1-8H,9H2
InChI key:InChIKey=FCMOEXPCHJZSIG-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)c1ccc(cc1)I)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.