CymitQuimica logo

CAS 898784-56-0

:

6-Methoxy-γ-oxo-3-pyridinebutanoic acid

Description:
6-Methoxy-γ-oxo-3-pyridinebutanoic acid, with the CAS number 898784-56-0, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a methoxy group (-OCH3) and a keto group (C=O) adjacent to a carboxylic acid functional group (-COOH). The methoxy group contributes to the compound's solubility and reactivity, while the keto and carboxylic acid functionalities can participate in various chemical reactions, including esterification and acid-base reactions. The pyridine moiety often imparts biological activity, making such compounds of interest in medicinal chemistry. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are influenced by its molecular structure. Overall, 6-Methoxy-γ-oxo-3-pyridinebutanoic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C10H11NO4
InChI:InChI=1S/C10H11NO4/c1-15-9-4-2-7(6-11-9)8(12)3-5-10(13)14/h2,4,6H,3,5H2,1H3,(H,13,14)
InChI key:InChIKey=QTQSOGJEIFPNMN-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(=O)C=1C=CC(OC)=NC1
Synonyms:
  • 6-Methoxy-γ-oxo-3-pyridinebutanoic acid
  • 3-Pyridinebutanoic acid, 6-methoxy-γ-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.