CymitQuimica logo

CAS 898784-58-2

:

6-Methoxy-δ-oxo-3-pyridinepentanoic acid

Description:
6-Methoxy-δ-oxo-3-pyridinepentanoic acid, identified by its CAS number 898784-58-2, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a methoxy group (-OCH3) and a keto group (C=O) adjacent to the pyridine structure, contributing to its reactivity and potential biological activity. The pentanoic acid moiety indicates that it has a five-carbon chain with a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The methoxy group can influence the compound's solubility and polarity, affecting its interaction with biological systems. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. However, detailed studies on its biological activity, toxicity, and applications would be necessary to fully understand its potential uses in various fields.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-16-10-6-5-8(7-12-10)9(13)3-2-4-11(14)15/h5-7H,2-4H2,1H3,(H,14,15)
InChI key:InChIKey=JITCYTVJGKKRSI-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)(=O)C=1C=CC(OC)=NC1
Synonyms:
  • 3-Pyridinepentanoic acid, 6-methoxy-δ-oxo-
  • 6-Methoxy-δ-oxo-3-pyridinepentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.