CAS 898784-66-2

1-(2-Chloro-4-pyridinyl)-1-pentanone

Description:

1-(2-Chloro-4-pyridinyl)-1-pentanone, with the CAS number 898784-66-2, is a chemical compound characterized by its pyridine ring and a pentanone structure. This compound features a chloro substituent at the 2-position of the pyridine ring, which contributes to its reactivity and potential biological activity. The presence of the carbonyl group (ketone) in the pentanone moiety suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and structure. Its polar functional groups may influence its solubility in polar solvents, while the hydrophobic pentane chain may enhance its solubility in non-polar solvents. Due to its structural features, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1S/C10H12ClNO/c1-2-3-4-9(13)8-5-6-12-10(11)7-8/h5-7H,2-4H2,1H3

InChI key: InChIKey=HRCOUUGWAXCTQP-UHFFFAOYSA-N

SMILES: C(CCCC)(=O)C=1C=C(Cl)N=CC1

Synonyms:

• 1-Pentanone, 1-(2-chloro-4-pyridinyl)-
• 1-(2-Chloro-4-pyridinyl)-1-pentanone

2-Chloro-4-valerylpyridine

CAS: 898784-66-2

Formula: C₁₀H₁₂ClNO

Purity: 97.0%

Molecular weight: 197.66

Ref: 10-F202695