CAS 898784-67-3
:1-(2-bromophenyl)-2-(3-fluorophenyl)ethanone
Description:
1-(2-Bromophenyl)-2-(3-fluorophenyl)ethanone, with the CAS number 898784-67-3, is an organic compound characterized by its ketone functional group and the presence of bromine and fluorine substituents on the aromatic rings. This compound typically appears as a solid or crystalline substance, exhibiting a relatively high melting point due to the presence of strong intermolecular forces. Its molecular structure features a central ethanone moiety, which contributes to its reactivity, particularly in nucleophilic addition reactions. The bromine and fluorine atoms introduce unique electronic effects, influencing the compound's reactivity and stability. Additionally, the presence of these halogens can enhance the compound's lipophilicity, potentially affecting its solubility in organic solvents. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex chemical syntheses. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C14H10BrFO
InChI:InChI=1/C14H10BrFO/c15-13-7-2-1-6-12(13)14(17)9-10-4-3-5-11(16)8-10/h1-8H,9H2
SMILES:c1ccc(c(c1)C(=O)Cc1cccc(c1)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.