CAS 898784-69-5

Ethanone, 1-(3-bromophenyl)-2-(3-fluorophenyl)-

Description:

Ethanone, 1-(3-bromophenyl)-2-(3-fluorophenyl)-, also known by its CAS number 898784-69-5, is an organic compound characterized by its ketone functional group and the presence of two aromatic substituents. The structure features a central ethanone moiety with a bromophenyl group and a fluorophenyl group attached at the 1 and 2 positions, respectively. This compound is likely to exhibit distinct physical and chemical properties due to the influence of the halogen substituents, which can affect its reactivity, polarity, and overall stability. The bromine and fluorine atoms can introduce unique electronic effects, potentially enhancing the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of these halogens may also influence the compound's solubility in various solvents and its interaction with biological systems, making it of interest in medicinal chemistry and material science. Overall, the specific characteristics of this compound would depend on its molecular structure and the arrangement of its substituents.

Formula: C₁₄H₁₀BrFO

InChI: InChI=1S/C14H10BrFO/c15-12-5-2-4-11(9-12)14(17)8-10-3-1-6-13(16)7-10/h1-7,9H,8H2

InChI key: InChIKey=INUNYUXLMSXYTA-UHFFFAOYSA-N

SMILES: C(C(=O)C1=CC(Br)=CC=C1)C2=CC(F)=CC=C2

Synonyms:

• Ethanone, 1-(3-bromophenyl)-2-(3-fluorophenyl)-
• 1-(3-Bromophenyl)-2-(3-fluorophenyl)ethan-1-one