CAS 898784-73-1

Ethanone, 2-(2-fluorophenyl)-1-(2-iodophenyl)-

Description:

Ethanone, 2-(2-fluorophenyl)-1-(2-iodophenyl)-, also known by its CAS number 898784-73-1, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic substituents. The structure features a central ethanone moiety, with a fluorophenyl group and an iodophenyl group attached to the carbon atoms adjacent to the carbonyl. This compound exhibits properties typical of aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents. The presence of fluorine and iodine can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical reactivity. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis and applications would typically involve methods that allow for the selective introduction of the halogenated phenyl groups onto the ethanone framework.

Formula: C₁₄H₁₀FIO

InChI: InChI=1S/C14H10FIO/c15-12-7-3-1-5-10(12)9-14(17)11-6-2-4-8-13(11)16/h1-8H,9H2

InChI key: InChIKey=MDENDEQQGSYZAC-UHFFFAOYSA-N

SMILES: C(C(=O)C1=C(I)C=CC=C1)C2=C(F)C=CC=C2

Synonyms:

• 2-(2-Fluorophenyl)-1-(2-iodophenyl)ethan-1-one
• Ethanone, 2-(2-fluorophenyl)-1-(2-iodophenyl)-