CAS 898784-75-3

Ethanone, 2-(2-fluorophenyl)-1-(3-iodophenyl)-

Description:

Ethanone, 2-(2-fluorophenyl)-1-(3-iodophenyl)-, also known by its CAS number 898784-75-3, is an organic compound characterized by its ketone functional group and the presence of both fluorine and iodine substituents on its aromatic rings. This compound features a two-phenyl structure, where one phenyl group is substituted with a fluorine atom at the para position, and the other is substituted with an iodine atom at the meta position. The presence of these halogen atoms can significantly influence the compound's reactivity, polarity, and overall chemical behavior. Ethanone derivatives are often studied for their potential applications in pharmaceuticals and materials science due to their unique electronic properties and ability to participate in various chemical reactions. Additionally, the presence of halogens can enhance the compound's biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₁₄H₁₀FIO

InChI: InChI=1S/C14H10FIO/c15-13-7-2-1-4-10(13)9-14(17)11-5-3-6-12(16)8-11/h1-8H,9H2

InChI key: InChIKey=XPUXFIZIEPKFEO-UHFFFAOYSA-N

SMILES: C(CC1=C(F)C=CC=C1)(=O)C2=CC(I)=CC=C2

Synonyms:

• 2-(2-Fluorophenyl)-1-(3-iodophenyl)ethan-1-one
• Ethanone, 2-(2-fluorophenyl)-1-(3-iodophenyl)-