CAS 898784-77-5
:Ethanone, 2-(3-fluorophenyl)-1-(2-iodophenyl)-
Description:
Ethanone, 2-(3-fluorophenyl)-1-(2-iodophenyl)-, also known by its CAS number 898784-77-5, is an organic compound characterized by its ketone functional group and substituted aromatic rings. This compound features a central ethanone moiety, where the carbonyl group is flanked by two distinct phenyl groups: one containing a fluorine atom in the meta position and the other containing an iodine atom in the ortho position. The presence of these halogen substituents can significantly influence the compound's chemical reactivity, polarity, and overall stability. Typically, such compounds are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. The fluorine atom may enhance lipophilicity and metabolic stability, while the iodine atom can facilitate certain types of chemical reactions, such as nucleophilic substitutions. Overall, the unique combination of functional groups and substituents in this compound makes it a subject of interest for further research and application in various chemical fields.
Formula:C14H10FIO
InChI:InChI=1S/C14H10FIO/c15-11-5-3-4-10(8-11)9-14(17)12-6-1-2-7-13(12)16/h1-8H,9H2
InChI key:InChIKey=VDDKYJWRHCISTD-UHFFFAOYSA-N
SMILES:C(C(=O)C1=C(I)C=CC=C1)C2=CC(F)=CC=C2
Synonyms:- 2-(3-Fluorophenyl)-1-(2-iodophenyl)ethan-1-one
- Ethanone, 2-(3-fluorophenyl)-1-(2-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.