CAS 898784-82-2

1-(2-Chloro-4-pyridinyl)-1-tridecanone

Description:

1-(2-Chloro-4-pyridinyl)-1-tridecanone, with the CAS number 898784-82-2, is an organic compound characterized by its unique structure that includes a pyridine ring and a long aliphatic chain. The presence of the chloro substituent on the pyridine ring contributes to its reactivity and potential applications in various chemical processes. This compound typically exhibits moderate to high lipophilicity due to the long tridecanone chain, which can influence its solubility in organic solvents and its behavior in biological systems. The ketone functional group is indicative of its potential as a precursor in synthetic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may display specific biological activities, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 1-(2-Chloro-4-pyridinyl)-1-tridecanone is a compound with diverse potential uses, warranting further investigation into its properties and applications.

Formula: C₁₈H₂₈ClNO

InChI: InChI=1S/C18H28ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-17(21)16-13-14-20-18(19)15-16/h13-15H,2-12H2,1H3

InChI key: InChIKey=DWISDODEJRIBLP-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCCCC)(=O)C=1C=C(Cl)N=CC1

Synonyms:

• 1-Tridecanone, 1-(2-chloro-4-pyridinyl)-
• 1-(2-Chloro-4-pyridinyl)-1-tridecanone