CAS 898784-83-3
:2-(4-fluorophenyl)-1-(2-iodophenyl)ethanone
Description:
2-(4-Fluorophenyl)-1-(2-iodophenyl)ethanone, with the CAS number 898784-83-3, is an organic compound characterized by its ketone functional group and the presence of both fluorine and iodine substituents on its aromatic rings. This compound features a central ethanone structure, where the carbonyl group (C=O) is flanked by two phenyl groups, one of which has a fluorine atom at the para position and the other an iodine atom at the ortho position. The presence of these halogens can significantly influence the compound's reactivity, stability, and solubility, as well as its potential applications in pharmaceuticals and materials science. Typically, compounds like this may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens, which can affect their behavior in chemical reactions. Additionally, the compound's molecular structure suggests potential for various synthetic pathways, making it a candidate for further research in organic synthesis and medicinal chemistry.
Formula:C14H10FIO
InChI:InChI=1/C14H10FIO/c15-11-7-5-10(6-8-11)9-14(17)12-3-1-2-4-13(12)16/h1-8H,9H2
InChI key:InChIKey=HFAFMGVCUWKAON-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(F)C=C1)(=O)C2=C(I)C=CC=C2
Synonyms:- 2-(4-Fluorophenyl)-1-(2-iodophenyl)ethan-1-one
- Ethanone, 2-(4-fluorophenyl)-1-(2-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.