CymitQuimica logo

CAS 898784-84-4

:

propyl 2-chloropyridine-4-carboxylate

Description:
Propyl 2-chloropyridine-4-carboxylate is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 4-position with a carboxylate group. The propyl group serves as an alkyl substituent, contributing to the compound's hydrophobic characteristics. This compound typically exhibits moderate polarity due to the presence of the carboxylate functional group, which can engage in hydrogen bonding. It is likely to be a solid or liquid at room temperature, depending on its specific structural arrangement and intermolecular interactions. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Propyl 2-chloropyridine-4-carboxylate may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its functional groups. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C9H10ClNO2
InChI:InChI=1/C9H10ClNO2/c1-2-5-13-9(12)7-3-4-11-8(10)6-7/h3-4,6H,2,5H2,1H3
SMILES:CCCOC(=O)c1ccnc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.