CymitQuimica logo

CAS 898784-85-5

:

2-(4-fluorophenyl)-1-(3-iodophenyl)ethanone

Description:
2-(4-Fluorophenyl)-1-(3-iodophenyl)ethanone, with the CAS number 898784-85-5, is an organic compound characterized by its ketone functional group and the presence of both fluorine and iodine substituents on its aromatic rings. This compound features a central ethanone structure, where the carbonyl group (C=O) is flanked by two phenyl groups, one of which has a fluorine atom at the para position and the other an iodine atom at the meta position. The presence of these halogens can significantly influence the compound's reactivity, stability, and potential applications in pharmaceuticals or materials science. Generally, compounds with such substituents may exhibit interesting electronic properties and can participate in various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the molecular structure suggests potential for interactions in biological systems, making it a candidate for further study in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C14H10FIO
InChI:InChI=1/C14H10FIO/c15-12-6-4-10(5-7-12)8-14(17)11-2-1-3-13(16)9-11/h1-7,9H,8H2
SMILES:c1cc(cc(c1)I)C(=O)Cc1ccc(cc1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.