CymitQuimica logo

CAS 898784-86-6

:

butyl 2-chloropyridine-4-carboxylate

Description:
Butyl 2-chloropyridine-4-carboxylate is an organic compound characterized by its pyridine ring, which is substituted with a carboxylate group and a chlorine atom. This compound typically exhibits a moderate polarity due to the presence of the carboxylate functional group, which can engage in hydrogen bonding and dipole interactions. The butyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. The chlorine atom introduces additional reactivity, making it a potential candidate for further chemical transformations. This compound may be utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest that it may exhibit biological activity, although specific biological properties would need to be evaluated through empirical studies. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, butyl 2-chloropyridine-4-carboxylate represents a versatile building block in organic synthesis.
Formula:C10H12ClNO2
InChI:InChI=1/C10H12ClNO2/c1-2-3-6-14-10(13)8-4-5-12-9(11)7-8/h4-5,7H,2-3,6H2,1H3
SMILES:CCCCOC(=O)c1ccnc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.